C19H21N3O2 — CID 42688090
6-(1,4-diazepan-1-yl)-8-methoxybenzo[b][1,4]benzoxazepine (PubChem CID 42688090) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 6-(1,4-diazepan-1-yl)-8-methoxybenzo[b][1,4]benzoxazepine.
| Compound Name | 6-(1,4-diazepan-1-yl)-8-methoxybenzo[b][1,4]benzoxazepine |
|---|---|
| PubChem CID | 42688090 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 6-(1,4-diazepan-1-yl)-8-methoxybenzo[b][1,4]benzoxazepine |
| SMILES | COc1ccc2c(c1)C(N1CCCNCC1)=Nc1ccccc1O2 |
| InChI | InChI=1S/C19H21N3O2/c1-23-14-7-8-17-15(13-14)19(22-11-4-9-20-10-12-22)21-16-5-2-3-6-18(16)24-17/h2-3,5-8,13,20H,4,9-12H2,1H3 |
| InChIKey | MJZUMTCNCXAHFR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |