About 1-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-3-prop-2-enyl-1-(pyridin-2-ylmethyl)urea
1-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-3-prop-2-enyl-1-(pyridin-2-ylmethyl)urea (PubChem CID 42691320) has the molecular formula C23H24N4O2
and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-3-prop-2-enyl-1-(pyridin-2-ylmethyl)urea.
Molecular Properties
| Compound Name | 1-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-3-prop-2-enyl-1-(pyridin-2-ylmethyl)urea |
| PubChem CID | 42691320 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 1-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-3-prop-2-enyl-1-(pyridin-2-ylmethyl)urea |
| SMILES | C=CCNC(=O)N(Cc1ccccn1)c1ccc(Oc2cccc(C)c2C)nc1 |
| InChI | InChI=1S/C23H24N4O2/c1-4-13-25-23(28)27(16-19-9-5-6-14-24-19)20-11-12-22(26-15-20)29-21-10-7-8-17(2)18(21)3/h4-12,14-15H,1,13,16H2,2-3H3,(H,25,28) |
| InChIKey | PEBWHSIMEISUIX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-3-prop-2-enyl-1-(pyridin-2-ylmethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-3-prop-2-enyl-1-(pyridin-2-ylmethyl)urea?
The IUPAC name of 1-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-3-prop-2-enyl-1-(pyridin-2-ylmethyl)urea (CID 42691320) is 1-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-3-prop-2-enyl-1-(pyridin-2-ylmethyl)urea.
What is the SMILES notation for 1-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-3-prop-2-enyl-1-(pyridin-2-ylmethyl)urea?
The canonical SMILES for 1-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-3-prop-2-enyl-1-(pyridin-2-ylmethyl)urea is C=CCNC(=O)N(Cc1ccccn1)c1ccc(Oc2cccc(C)c2C)nc1.
What is the InChIKey of 1-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-3-prop-2-enyl-1-(pyridin-2-ylmethyl)urea?
The InChIKey is PEBWHSIMEISUIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O2/c1-4-13-25-23(28)27(16-19-9-5-6-14-24-19)20-11-12-22(26-15-20)29-21-10-7-8-17(2)18(21)3/h4-12,14-15H,1,13,16H2,2-3H3,(H,25,28).
What are the key properties of 1-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-3-prop-2-enyl-1-(pyridin-2-ylmethyl)urea?
1-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-3-prop-2-enyl-1-(pyridin-2-ylmethyl)urea has a molecular weight of 388.47 g/mol, XLogP of 4.79, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(2,3-dimethylphenoxy)-3-pyridinyl]-3-prop-2-enyl-1-(pyridin-2-ylmethyl)urea is sourced from PubChem (CID 42691320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).