C19H24F3NO3 — CID 42691423
ethyl 4-oxo-4-[4-[[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]butanoate (PubChem CID 42691423) has the molecular formula C19H24F3NO3 and a molecular weight of 371.40 g/mol. Its IUPAC name is ethyl 4-oxo-4-[4-[[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]butanoate.
| Compound Name | ethyl 4-oxo-4-[4-[[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]butanoate |
|---|---|
| PubChem CID | 42691423 |
| Molecular Formula | C19H24F3NO3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | ethyl 4-oxo-4-[4-[[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]butanoate |
| SMILES | CCOC(=O)CCC(=O)N1CCC(Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H24F3NO3/c1-2-26-18(25)8-7-17(24)23-11-9-15(10-12-23)13-14-3-5-16(6-4-14)19(20,21)22/h3-6,15H,2,7-13H2,1H3 |
| InChIKey | INQHPRRQPLPUIQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |