C13H13N5O — CID 42692566
N-(cyanomethyl)-N,5-dimethyl-1-phenyl-1,2,4-triazole-3-carboxamide (PubChem CID 42692566) has the molecular formula C13H13N5O and a molecular weight of 255.28 g/mol. Its IUPAC name is N-(cyanomethyl)-N,5-dimethyl-1-phenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(cyanomethyl)-N,5-dimethyl-1-phenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 42692566 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | N-(cyanomethyl)-N,5-dimethyl-1-phenyl-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1nc(C(=O)N(C)CC#N)nn1-c1ccccc1 |
| InChI | InChI=1S/C13H13N5O/c1-10-15-12(13(19)17(2)9-8-14)16-18(10)11-6-4-3-5-7-11/h3-7H,9H2,1-2H3 |
| InChIKey | ANIAYTQGOGUSOX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 74.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|