About (5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-[3-(dimethylamino)pyrrolidin-1-yl]methanone
(5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-[3-(dimethylamino)pyrrolidin-1-yl]methanone (PubChem CID 42692847) has the molecular formula C22H25N5O
and a molecular weight of 375.48 g/mol. Its IUPAC name is (5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-[3-(dimethylamino)pyrrolidin-1-yl]methanone.
Molecular Properties
| Compound Name | (5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-[3-(dimethylamino)pyrrolidin-1-yl]methanone |
| PubChem CID | 42692847 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | (5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-[3-(dimethylamino)pyrrolidin-1-yl]methanone |
| SMILES | CN(C)C1CCN(C(=O)c2nc(Cc3ccccc3)n(-c3ccccc3)n2)C1 |
| InChI | InChI=1S/C22H25N5O/c1-25(2)19-13-14-26(16-19)22(28)21-23-20(15-17-9-5-3-6-10-17)27(24-21)18-11-7-4-8-12-18/h3-12,19H,13-16H2,1-2H3 |
| InChIKey | ZDNSOWRYLKLIIW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-[3-(dimethylamino)pyrrolidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-[3-(dimethylamino)pyrrolidin-1-yl]methanone?
The IUPAC name of (5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-[3-(dimethylamino)pyrrolidin-1-yl]methanone (CID 42692847) is (5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-[3-(dimethylamino)pyrrolidin-1-yl]methanone.
What is the SMILES notation for (5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-[3-(dimethylamino)pyrrolidin-1-yl]methanone?
The canonical SMILES for (5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-[3-(dimethylamino)pyrrolidin-1-yl]methanone is CN(C)C1CCN(C(=O)c2nc(Cc3ccccc3)n(-c3ccccc3)n2)C1.
What is the InChIKey of (5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-[3-(dimethylamino)pyrrolidin-1-yl]methanone?
The InChIKey is ZDNSOWRYLKLIIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N5O/c1-25(2)19-13-14-26(16-19)22(28)21-23-20(15-17-9-5-3-6-10-17)27(24-21)18-11-7-4-8-12-18/h3-12,19H,13-16H2,1-2H3.
What are the key properties of (5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-[3-(dimethylamino)pyrrolidin-1-yl]methanone?
(5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-[3-(dimethylamino)pyrrolidin-1-yl]methanone has a molecular weight of 375.48 g/mol, XLogP of 2.63, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-benzyl-1-phenyl-1,2,4-triazol-3-yl)-[3-(dimethylamino)pyrrolidin-1-yl]methanone is sourced from PubChem (CID 42692847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).