C22H37N3O3 — CID 42693449
cyclohexyl-[4-[4-(morpholine-4-carbonyl)piperidin-1-yl]piperidin-1-yl]methanone (PubChem CID 42693449) has the molecular formula C22H37N3O3 and a molecular weight of 391.56 g/mol. Its IUPAC name is cyclohexyl-[4-[4-(morpholine-4-carbonyl)piperidin-1-yl]piperidin-1-yl]methanone.
| Compound Name | cyclohexyl-[4-[4-(morpholine-4-carbonyl)piperidin-1-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 42693449 |
| Molecular Formula | C22H37N3O3 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | cyclohexyl-[4-[4-(morpholine-4-carbonyl)piperidin-1-yl]piperidin-1-yl]methanone |
| SMILES | O=C(C1CCN(C2CCN(C(=O)C3CCCCC3)CC2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C22H37N3O3/c26-21(18-4-2-1-3-5-18)24-12-8-20(9-13-24)23-10-6-19(7-11-23)22(27)25-14-16-28-17-15-25/h18-20H,1-17H2 |
| InChIKey | BJCOEVKWQWOYII-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |