C21H30ClN3O2 — CID 42693619
N-benzyl-1-[1-(2-chloroacetyl)piperidin-4-yl]-N-methylpiperidine-4-carboxamide (PubChem CID 42693619) has the molecular formula C21H30ClN3O2 and a molecular weight of 391.94 g/mol. Its IUPAC name is N-benzyl-1-[1-(2-chloroacetyl)piperidin-4-yl]-N-methylpiperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[1-(2-chloroacetyl)piperidin-4-yl]-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 42693619 |
| Molecular Formula | C21H30ClN3O2 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | N-benzyl-1-[1-(2-chloroacetyl)piperidin-4-yl]-N-methylpiperidine-4-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)C1CCN(C2CCN(C(=O)CCl)CC2)CC1 |
| InChI | InChI=1S/C21H30ClN3O2/c1-23(16-17-5-3-2-4-6-17)21(27)18-7-11-24(12-8-18)19-9-13-25(14-10-19)20(26)15-22/h2-6,18-19H,7-16H2,1H3 |
| InChIKey | HLDVEWOELHMKEO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|