C22H24F3N3O — CID 42694186
N-[2-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]octanamide (PubChem CID 42694186) has the molecular formula C22H24F3N3O and a molecular weight of 403.45 g/mol. Its IUPAC name is N-[2-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]octanamide.
| Compound Name | N-[2-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]octanamide |
|---|---|
| PubChem CID | 42694186 |
| Molecular Formula | C22H24F3N3O |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[2-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1c(-c2ccc(C(F)(F)F)cc2)nc2ccccn12 |
| InChI | InChI=1S/C22H24F3N3O/c1-2-3-4-5-6-10-19(29)27-21-20(26-18-9-7-8-15-28(18)21)16-11-13-17(14-12-16)22(23,24)25/h7-9,11-15H,2-6,10H2,1H3,(H,27,29) |
| InChIKey | YRQLZIPUBMWTBF-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|