About 4-[benzotriazol-2-yl(phenyl)methyl]-N,N-dimethylaniline
4-[benzotriazol-2-yl(phenyl)methyl]-N,N-dimethylaniline (PubChem CID 4269444) has the molecular formula C21H20N4
and a molecular weight of 328.42 g/mol. Its IUPAC name is 4-[benzotriazol-2-yl(phenyl)methyl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-[benzotriazol-2-yl(phenyl)methyl]-N,N-dimethylaniline |
| PubChem CID | 4269444 |
| Molecular Formula | C21H20N4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 4-[benzotriazol-2-yl(phenyl)methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(c2ccccc2)n2nc3ccccc3n2)cc1 |
| InChI | InChI=1S/C21H20N4/c1-24(2)18-14-12-17(13-15-18)21(16-8-4-3-5-9-16)25-22-19-10-6-7-11-20(19)23-25/h3-15,21H,1-2H3 |
| InChIKey | SNCSOLMQCUISAA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[benzotriazol-2-yl(phenyl)methyl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[benzotriazol-2-yl(phenyl)methyl]-N,N-dimethylaniline?
The IUPAC name of 4-[benzotriazol-2-yl(phenyl)methyl]-N,N-dimethylaniline (CID 4269444) is 4-[benzotriazol-2-yl(phenyl)methyl]-N,N-dimethylaniline.
What is the SMILES notation for 4-[benzotriazol-2-yl(phenyl)methyl]-N,N-dimethylaniline?
The canonical SMILES for 4-[benzotriazol-2-yl(phenyl)methyl]-N,N-dimethylaniline is CN(C)c1ccc(C(c2ccccc2)n2nc3ccccc3n2)cc1.
What is the InChIKey of 4-[benzotriazol-2-yl(phenyl)methyl]-N,N-dimethylaniline?
The InChIKey is SNCSOLMQCUISAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4/c1-24(2)18-14-12-17(13-15-18)21(16-8-4-3-5-9-16)25-22-19-10-6-7-11-20(19)23-25/h3-15,21H,1-2H3.
What are the key properties of 4-[benzotriazol-2-yl(phenyl)methyl]-N,N-dimethylaniline?
4-[benzotriazol-2-yl(phenyl)methyl]-N,N-dimethylaniline has a molecular weight of 328.42 g/mol, XLogP of 4.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[benzotriazol-2-yl(phenyl)methyl]-N,N-dimethylaniline is sourced from PubChem (CID 4269444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).