C24H19N3O7 — CID 4269458
4-[2-[[1-(2,4-dimethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]pyrrol-1-yl]benzoic acid (PubChem CID 4269458) has the molecular formula C24H19N3O7 and a molecular weight of 461.43 g/mol. Its IUPAC name is 4-[2-[[1-(2,4-dimethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]pyrrol-1-yl]benzoic acid.
| Compound Name | 4-[2-[[1-(2,4-dimethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 4269458 |
| Molecular Formula | C24H19N3O7 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 4-[2-[[1-(2,4-dimethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]pyrrol-1-yl]benzoic acid |
| SMILES | COc1ccc(N2C(=O)NC(=O)C(=Cc3cccn3-c3ccc(C(=O)O)cc3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C24H19N3O7/c1-33-17-9-10-19(20(13-17)34-2)27-22(29)18(21(28)25-24(27)32)12-16-4-3-11-26(16)15-7-5-14(6-8-15)23(30)31/h3-13H,1-2H3,(H,30,31)(H,25,28,32) |
| InChIKey | BUPXEMQMOIHNMI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|