C20H20N4O2S — CID 42694978
1-[3-(2-methylphenyl)-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-2-phenylmethoxyethanone (PubChem CID 42694978) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-[3-(2-methylphenyl)-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-2-phenylmethoxyethanone.
| Compound Name | 1-[3-(2-methylphenyl)-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-2-phenylmethoxyethanone |
|---|---|
| PubChem CID | 42694978 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-[3-(2-methylphenyl)-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-2-phenylmethoxyethanone |
| SMILES | Cc1ccccc1-c1nnc2n1N(C(=O)COCc1ccccc1)CCS2 |
| InChI | InChI=1S/C20H20N4O2S/c1-15-7-5-6-10-17(15)19-21-22-20-24(19)23(11-12-27-20)18(25)14-26-13-16-8-3-2-4-9-16/h2-10H,11-14H2,1H3 |
| InChIKey | FTCBTUMPSKVZHS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |