About N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-(2-piperazin-1-ylethyl)pentanamide
N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-(2-piperazin-1-ylethyl)pentanamide (PubChem CID 42695365) has the molecular formula C21H37N3O
and a molecular weight of 347.55 g/mol. Its IUPAC name is N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-(2-piperazin-1-ylethyl)pentanamide.
Molecular Properties
| Compound Name | N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-(2-piperazin-1-ylethyl)pentanamide |
| PubChem CID | 42695365 |
| Molecular Formula | C21H37N3O |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.29 |
| IUPAC Name | N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-(2-piperazin-1-ylethyl)pentanamide |
| SMILES | CCCCC(=O)N(CCN1CCNCC1)CC1=CCC2CC1C2(C)C |
| InChI | InChI=1S/C21H37N3O/c1-4-5-6-20(25)24(14-13-23-11-9-22-10-12-23)16-17-7-8-18-15-19(17)21(18,2)3/h7,18-19,22H,4-6,8-16H2,1-3H3 |
| InChIKey | WNGVSILLUBEWDY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-(2-piperazin-1-ylethyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-(2-piperazin-1-ylethyl)pentanamide?
The IUPAC name of N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-(2-piperazin-1-ylethyl)pentanamide (CID 42695365) is N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-(2-piperazin-1-ylethyl)pentanamide.
What is the SMILES notation for N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-(2-piperazin-1-ylethyl)pentanamide?
The canonical SMILES for N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-(2-piperazin-1-ylethyl)pentanamide is CCCCC(=O)N(CCN1CCNCC1)CC1=CCC2CC1C2(C)C.
What is the InChIKey of N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-(2-piperazin-1-ylethyl)pentanamide?
The InChIKey is WNGVSILLUBEWDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H37N3O/c1-4-5-6-20(25)24(14-13-23-11-9-22-10-12-23)16-17-7-8-18-15-19(17)21(18,2)3/h7,18-19,22H,4-6,8-16H2,1-3H3.
What are the key properties of N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-(2-piperazin-1-ylethyl)pentanamide?
N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-(2-piperazin-1-ylethyl)pentanamide has a molecular weight of 347.55 g/mol, XLogP of 2.90, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-(2-piperazin-1-ylethyl)pentanamide is sourced from PubChem (CID 42695365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).