About 3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-methylpropyl)urea
3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-methylpropyl)urea (PubChem CID 42696683) has the molecular formula C21H36N2O
and a molecular weight of 332.53 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-methylpropyl)urea.
Molecular Properties
| Compound Name | 3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-methylpropyl)urea |
| PubChem CID | 42696683 |
| Molecular Formula | C21H36N2O |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | 3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-methylpropyl)urea |
| SMILES | CC(C)CN(CC1=CCC2CC1C2(C)C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C21H36N2O/c1-15(2)13-23(20(24)22-18-8-6-5-7-9-18)14-16-10-11-17-12-19(16)21(17,3)4/h10,15,17-19H,5-9,11-14H2,1-4H3,(H,22,24) |
| InChIKey | LSHWPLPRHZZDNW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-methylpropyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-methylpropyl)urea?
The IUPAC name of 3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-methylpropyl)urea (CID 42696683) is 3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-methylpropyl)urea.
What is the SMILES notation for 3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-methylpropyl)urea?
The canonical SMILES for 3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-methylpropyl)urea is CC(C)CN(CC1=CCC2CC1C2(C)C)C(=O)NC1CCCCC1.
What is the InChIKey of 3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-methylpropyl)urea?
The InChIKey is LSHWPLPRHZZDNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36N2O/c1-15(2)13-23(20(24)22-18-8-6-5-7-9-18)14-16-10-11-17-12-19(16)21(17,3)4/h10,15,17-19H,5-9,11-14H2,1-4H3,(H,22,24).
What are the key properties of 3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-methylpropyl)urea?
3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-methylpropyl)urea has a molecular weight of 332.53 g/mol, XLogP of 4.98, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-methylpropyl)urea is sourced from PubChem (CID 42696683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).