About 1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2,4-difluorophenyl)urea
1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2,4-difluorophenyl)urea (PubChem CID 42697177) has the molecular formula C28H29F2N3O2
and a molecular weight of 477.56 g/mol. Its IUPAC name is 1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2,4-difluorophenyl)urea.
Molecular Properties
| Compound Name | 1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2,4-difluorophenyl)urea |
| PubChem CID | 42697177 |
| Molecular Formula | C28H29F2N3O2 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1F)NC(Cc1ccccc1)C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H29F2N3O2/c29-23-11-12-25(24(30)19-23)31-28(35)32-26(18-21-9-5-2-6-10-21)27(34)33-15-13-22(14-16-33)17-20-7-3-1-4-8-20/h1-12,19,22,26H,13-18H2,(H2,31,32,35) |
| InChIKey | KJKJGWXPOPLNMZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2,4-difluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2,4-difluorophenyl)urea?
The IUPAC name of 1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2,4-difluorophenyl)urea (CID 42697177) is 1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2,4-difluorophenyl)urea.
What is the SMILES notation for 1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2,4-difluorophenyl)urea?
The canonical SMILES for 1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2,4-difluorophenyl)urea is O=C(Nc1ccc(F)cc1F)NC(Cc1ccccc1)C(=O)N1CCC(Cc2ccccc2)CC1.
What is the InChIKey of 1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2,4-difluorophenyl)urea?
The InChIKey is KJKJGWXPOPLNMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29F2N3O2/c29-23-11-12-25(24(30)19-23)31-28(35)32-26(18-21-9-5-2-6-10-21)27(34)33-15-13-22(14-16-33)17-20-7-3-1-4-8-20/h1-12,19,22,26H,13-18H2,(H2,31,32,35).
What are the key properties of 1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2,4-difluorophenyl)urea?
1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2,4-difluorophenyl)urea has a molecular weight of 477.56 g/mol, XLogP of 5.18, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2,4-difluorophenyl)urea is sourced from PubChem (CID 42697177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).