C29H33N3O3 — CID 42697179
1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2-methoxyphenyl)urea (PubChem CID 42697179) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is 1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 42697179 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 1-[1-(4-benzylpiperidin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)NC(Cc1ccccc1)C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H33N3O3/c1-35-27-15-9-8-14-25(27)30-29(34)31-26(21-23-12-6-3-7-13-23)28(33)32-18-16-24(17-19-32)20-22-10-4-2-5-11-22/h2-15,24,26H,16-21H2,1H3,(H2,30,31,34) |
| InChIKey | FBWPDCAQRYWNLD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |