C23H27NO — CID 42697729
N-benzyl-N-[(E)-2-methyl-3-phenylprop-2-enyl]cyclopentanecarboxamide (PubChem CID 42697729) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is N-benzyl-N-[(E)-2-methyl-3-phenylprop-2-enyl]cyclopentanecarboxamide.
| Compound Name | N-benzyl-N-[(E)-2-methyl-3-phenylprop-2-enyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 42697729 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N-benzyl-N-[(E)-2-methyl-3-phenylprop-2-enyl]cyclopentanecarboxamide |
| SMILES | C/C(=C\c1ccccc1)CN(Cc1ccccc1)C(=O)C1CCCC1 |
| InChI | InChI=1S/C23H27NO/c1-19(16-20-10-4-2-5-11-20)17-24(18-21-12-6-3-7-13-21)23(25)22-14-8-9-15-22/h2-7,10-13,16,22H,8-9,14-15,17-18H2,1H3/b19-16+ |
| InChIKey | SHAJINNMQJLHHU-KNTRCKAVSA-N |
| XLogP | 5.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |