C23H26F3NO — CID 42698365
N-(2-phenylethyl)-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexanecarboxamide (PubChem CID 42698365) has the molecular formula C23H26F3NO and a molecular weight of 389.46 g/mol. Its IUPAC name is N-(2-phenylethyl)-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexanecarboxamide.
| Compound Name | N-(2-phenylethyl)-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 42698365 |
| Molecular Formula | C23H26F3NO |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N-(2-phenylethyl)-N-[[4-(trifluoromethyl)phenyl]methyl]cyclohexanecarboxamide |
| SMILES | O=C(C1CCCCC1)N(CCc1ccccc1)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H26F3NO/c24-23(25,26)21-13-11-19(12-14-21)17-27(16-15-18-7-3-1-4-8-18)22(28)20-9-5-2-6-10-20/h1,3-4,7-8,11-14,20H,2,5-6,9-10,15-17H2 |
| InChIKey | FHCIWDIGRZEOGG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |