C25H29N3O3 — CID 42699212
3-[butan-2-yl-[(4-methoxyphenyl)carbamoyl]amino]-N-naphthalen-2-ylpropanamide (PubChem CID 42699212) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 3-[butan-2-yl-[(4-methoxyphenyl)carbamoyl]amino]-N-naphthalen-2-ylpropanamide.
| Compound Name | 3-[butan-2-yl-[(4-methoxyphenyl)carbamoyl]amino]-N-naphthalen-2-ylpropanamide |
|---|---|
| PubChem CID | 42699212 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 3-[butan-2-yl-[(4-methoxyphenyl)carbamoyl]amino]-N-naphthalen-2-ylpropanamide |
| SMILES | CCC(C)N(CCC(=O)Nc1ccc2ccccc2c1)C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H29N3O3/c1-4-18(2)28(25(30)27-21-11-13-23(31-3)14-12-21)16-15-24(29)26-22-10-9-19-7-5-6-8-20(19)17-22/h5-14,17-18H,4,15-16H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | GYPNFWAHESUAJX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |