C31H43N3O2 — CID 42699430
N-benzyl-3-[cyclohexyl(cyclohexylcarbamoyl)amino]-N-(2-phenylethyl)propanamide (PubChem CID 42699430) has the molecular formula C31H43N3O2 and a molecular weight of 489.70 g/mol. Its IUPAC name is N-benzyl-3-[cyclohexyl(cyclohexylcarbamoyl)amino]-N-(2-phenylethyl)propanamide.
| Compound Name | N-benzyl-3-[cyclohexyl(cyclohexylcarbamoyl)amino]-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 42699430 |
| Molecular Formula | C31H43N3O2 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.34 |
| IUPAC Name | N-benzyl-3-[cyclohexyl(cyclohexylcarbamoyl)amino]-N-(2-phenylethyl)propanamide |
| SMILES | O=C(CCN(C(=O)NC1CCCCC1)C1CCCCC1)N(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H43N3O2/c35-30(33(25-27-15-7-2-8-16-27)23-21-26-13-5-1-6-14-26)22-24-34(29-19-11-4-12-20-29)31(36)32-28-17-9-3-10-18-28/h1-2,5-8,13-16,28-29H,3-4,9-12,17-25H2,(H,32,36) |
| InChIKey | AIOXMTJEKOALKS-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |