C28H38N2O3S — CID 42700905
N-[3-(4-benzylpiperidin-1-yl)-3-oxopropyl]-N-cyclohexyl-4-methylbenzenesulfonamide (PubChem CID 42700905) has the molecular formula C28H38N2O3S and a molecular weight of 482.69 g/mol. Its IUPAC name is N-[3-(4-benzylpiperidin-1-yl)-3-oxopropyl]-N-cyclohexyl-4-methylbenzenesulfonamide.
| Compound Name | N-[3-(4-benzylpiperidin-1-yl)-3-oxopropyl]-N-cyclohexyl-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 42700905 |
| Molecular Formula | C28H38N2O3S |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | N-[3-(4-benzylpiperidin-1-yl)-3-oxopropyl]-N-cyclohexyl-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCC(=O)N2CCC(Cc3ccccc3)CC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C28H38N2O3S/c1-23-12-14-27(15-13-23)34(32,33)30(26-10-6-3-7-11-26)21-18-28(31)29-19-16-25(17-20-29)22-24-8-4-2-5-9-24/h2,4-5,8-9,12-15,25-26H,3,6-7,10-11,16-22H2,1H3 |
| InChIKey | DKFHIJSNDYMRHZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |