C24H26ClN3O6 — CID 42701577
ethyl 1-[2-[(4-chloro-3-nitrobenzoyl)amino]-3-phenylpropanoyl]piperidine-3-carboxylate (PubChem CID 42701577) has the molecular formula C24H26ClN3O6 and a molecular weight of 487.94 g/mol. Its IUPAC name is ethyl 1-[2-[(4-chloro-3-nitrobenzoyl)amino]-3-phenylpropanoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[(4-chloro-3-nitrobenzoyl)amino]-3-phenylpropanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42701577 |
| Molecular Formula | C24H26ClN3O6 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | ethyl 1-[2-[(4-chloro-3-nitrobenzoyl)amino]-3-phenylpropanoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)C(Cc2ccccc2)NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C24H26ClN3O6/c1-2-34-24(31)18-9-6-12-27(15-18)23(30)20(13-16-7-4-3-5-8-16)26-22(29)17-10-11-19(25)21(14-17)28(32)33/h3-5,7-8,10-11,14,18,20H,2,6,9,12-13,15H2,1H3,(H,26,29) |
| InChIKey | HSYWXVVUUTZROO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|