C39H45NO2 — CID 42702315
N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-N-[(4-methoxyphenyl)methyl]naphthalene-2-carboxamide (PubChem CID 42702315) has the molecular formula C39H45NO2 and a molecular weight of 559.79 g/mol. Its IUPAC name is N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-N-[(4-methoxyphenyl)methyl]naphthalene-2-carboxamide.
| Compound Name | N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-N-[(4-methoxyphenyl)methyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 42702315 |
| Molecular Formula | C39H45NO2 |
| Molecular Weight | 559.79 g/mol |
| Exact Mass | 559.35 |
| IUPAC Name | N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-N-[(4-methoxyphenyl)methyl]naphthalene-2-carboxamide |
| SMILES | COc1ccc(CN(CC2(C)CCCC3(C)c4ccc(C(C)C)cc4CCC23)C(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C39H45NO2/c1-27(2)30-15-19-35-32(23-30)16-20-36-38(3,21-8-22-39(35,36)4)26-40(25-28-11-17-34(42-5)18-12-28)37(41)33-14-13-29-9-6-7-10-31(29)24-33/h6-7,9-15,17-19,23-24,27,36H,8,16,20-22,25-26H2,1-5H3 |
| InChIKey | UXMSZPIXFMGFOC-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.79 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |