C36H44FNO3 — CID 42702317
N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-N-[(4-fluorophenyl)methyl]-3,5-dimethoxybenzamide (PubChem CID 42702317) has the molecular formula C36H44FNO3 and a molecular weight of 557.75 g/mol. Its IUPAC name is N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-N-[(4-fluorophenyl)methyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-N-[(4-fluorophenyl)methyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 42702317 |
| Molecular Formula | C36H44FNO3 |
| Molecular Weight | 557.75 g/mol |
| Exact Mass | 557.33 |
| IUPAC Name | N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-N-[(4-fluorophenyl)methyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N(Cc2ccc(F)cc2)CC2(C)CCCC3(C)c4ccc(C(C)C)cc4CCC23)c1 |
| InChI | InChI=1S/C36H44FNO3/c1-24(2)26-10-14-32-27(18-26)11-15-33-35(3,16-7-17-36(32,33)4)23-38(22-25-8-12-29(37)13-9-25)34(39)28-19-30(40-5)21-31(20-28)41-6/h8-10,12-14,18-21,24,33H,7,11,15-17,22-23H2,1-6H3 |
| InChIKey | VHCKWVIINNBEKV-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.75 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |