C27H34BrNO — CID 42702950
N-[(2E)-2-benzylideneheptyl]-3-bromo-N-cyclohexylbenzamide (PubChem CID 42702950) has the molecular formula C27H34BrNO and a molecular weight of 468.48 g/mol. Its IUPAC name is N-[(2E)-2-benzylideneheptyl]-3-bromo-N-cyclohexylbenzamide.
| Compound Name | N-[(2E)-2-benzylideneheptyl]-3-bromo-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 42702950 |
| Molecular Formula | C27H34BrNO |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | N-[(2E)-2-benzylideneheptyl]-3-bromo-N-cyclohexylbenzamide |
| SMILES | CCCCC/C(=C\c1ccccc1)CN(C(=O)c1cccc(Br)c1)C1CCCCC1 |
| InChI | InChI=1S/C27H34BrNO/c1-2-3-6-14-23(19-22-12-7-4-8-13-22)21-29(26-17-9-5-10-18-26)27(30)24-15-11-16-25(28)20-24/h4,7-8,11-13,15-16,19-20,26H,2-3,5-6,9-10,14,17-18,21H2,1H3/b23-19+ |
| InChIKey | KPDDQNXKCSXGPB-FCDQGJHFSA-N |
| XLogP | 7.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|