C19H14Cl2N2OS — CID 4270301
4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-N-prop-2-enylbenzamide (PubChem CID 4270301) has the molecular formula C19H14Cl2N2OS and a molecular weight of 389.31 g/mol. Its IUPAC name is 4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-N-prop-2-enylbenzamide.
| Compound Name | 4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 4270301 |
| Molecular Formula | C19H14Cl2N2OS |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(-c2nc(-c3ccc(Cl)c(Cl)c3)cs2)cc1 |
| InChI | InChI=1S/C19H14Cl2N2OS/c1-2-9-22-18(24)12-3-5-13(6-4-12)19-23-17(11-25-19)14-7-8-15(20)16(21)10-14/h2-8,10-11H,1,9H2,(H,22,24) |
| InChIKey | UFDCGKWYGHTSOK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|