C25H32N2O2 — CID 42703090
N-(1-oxo-3-phenyl-1-pyrrolidin-1-ylpropan-2-yl)-4-pentylbenzamide (PubChem CID 42703090) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is N-(1-oxo-3-phenyl-1-pyrrolidin-1-ylpropan-2-yl)-4-pentylbenzamide.
| Compound Name | N-(1-oxo-3-phenyl-1-pyrrolidin-1-ylpropan-2-yl)-4-pentylbenzamide |
|---|---|
| PubChem CID | 42703090 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | N-(1-oxo-3-phenyl-1-pyrrolidin-1-ylpropan-2-yl)-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)NC(Cc2ccccc2)C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C25H32N2O2/c1-2-3-5-10-20-13-15-22(16-14-20)24(28)26-23(19-21-11-6-4-7-12-21)25(29)27-17-8-9-18-27/h4,6-7,11-16,23H,2-3,5,8-10,17-19H2,1H3,(H,26,28) |
| InChIKey | NJTSPVVWEDHKMU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|