C28H39N3O3 — CID 42703225
4-butyl-N-[3-(2-morpholin-4-ylethylamino)-3-oxopropyl]-N-(1-phenylethyl)benzamide (PubChem CID 42703225) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is 4-butyl-N-[3-(2-morpholin-4-ylethylamino)-3-oxopropyl]-N-(1-phenylethyl)benzamide.
| Compound Name | 4-butyl-N-[3-(2-morpholin-4-ylethylamino)-3-oxopropyl]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 42703225 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | 4-butyl-N-[3-(2-morpholin-4-ylethylamino)-3-oxopropyl]-N-(1-phenylethyl)benzamide |
| SMILES | CCCCc1ccc(C(=O)N(CCC(=O)NCCN2CCOCC2)C(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H39N3O3/c1-3-4-8-24-11-13-26(14-12-24)28(33)31(23(2)25-9-6-5-7-10-25)17-15-27(32)29-16-18-30-19-21-34-22-20-30/h5-7,9-14,23H,3-4,8,15-22H2,1-2H3,(H,29,32) |
| InChIKey | NUSYNENIPFRJGZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |