C28H24Cl2N2O2 — CID 42709304
1-benzhydryl-3-(3,4-dichlorophenyl)-1-[(2-methoxyphenyl)methyl]urea (PubChem CID 42709304) has the molecular formula C28H24Cl2N2O2 and a molecular weight of 491.42 g/mol. Its IUPAC name is 1-benzhydryl-3-(3,4-dichlorophenyl)-1-[(2-methoxyphenyl)methyl]urea.
| Compound Name | 1-benzhydryl-3-(3,4-dichlorophenyl)-1-[(2-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 42709304 |
| Molecular Formula | C28H24Cl2N2O2 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 1-benzhydryl-3-(3,4-dichlorophenyl)-1-[(2-methoxyphenyl)methyl]urea |
| SMILES | COc1ccccc1CN(C(=O)Nc1ccc(Cl)c(Cl)c1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24Cl2N2O2/c1-34-26-15-9-8-14-22(26)19-32(28(33)31-23-16-17-24(29)25(30)18-23)27(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-18,27H,19H2,1H3,(H,31,33) |
| InChIKey | MGAYBYCBXSERMY-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |