C24H26N4O5 — CID 4271012
3-benzyl-7-propyl-8-(3,4,5-trimethoxyphenyl)purine-2,6-dione (PubChem CID 4271012) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is 3-benzyl-7-propyl-8-(3,4,5-trimethoxyphenyl)purine-2,6-dione.
| Compound Name | 3-benzyl-7-propyl-8-(3,4,5-trimethoxyphenyl)purine-2,6-dione |
|---|---|
| PubChem CID | 4271012 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 3-benzyl-7-propyl-8-(3,4,5-trimethoxyphenyl)purine-2,6-dione |
| SMILES | CCCn1c(-c2cc(OC)c(OC)c(OC)c2)nc2c1c(=O)[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C24H26N4O5/c1-5-11-27-19-22(28(24(30)26-23(19)29)14-15-9-7-6-8-10-15)25-21(27)16-12-17(31-2)20(33-4)18(13-16)32-3/h6-10,12-13H,5,11,14H2,1-4H3,(H,26,29,30) |
| InChIKey | PMZXEKXKJYVPMH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |