C28H28ClF2N3O2 — CID 42710281
N-[2-[4-(2-chloro-2-phenylacetyl)piperazin-1-yl]ethyl]-4-fluoro-N-[(4-fluorophenyl)methyl]benzamide (PubChem CID 42710281) has the molecular formula C28H28ClF2N3O2 and a molecular weight of 512.00 g/mol. Its IUPAC name is N-[2-[4-(2-chloro-2-phenylacetyl)piperazin-1-yl]ethyl]-4-fluoro-N-[(4-fluorophenyl)methyl]benzamide.
| Compound Name | N-[2-[4-(2-chloro-2-phenylacetyl)piperazin-1-yl]ethyl]-4-fluoro-N-[(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 42710281 |
| Molecular Formula | C28H28ClF2N3O2 |
| Molecular Weight | 512.00 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | N-[2-[4-(2-chloro-2-phenylacetyl)piperazin-1-yl]ethyl]-4-fluoro-N-[(4-fluorophenyl)methyl]benzamide |
| SMILES | O=C(c1ccc(F)cc1)N(CCN1CCN(C(=O)C(Cl)c2ccccc2)CC1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C28H28ClF2N3O2/c29-26(22-4-2-1-3-5-22)28(36)33-17-14-32(15-18-33)16-19-34(20-21-6-10-24(30)11-7-21)27(35)23-8-12-25(31)13-9-23/h1-13,26H,14-20H2 |
| InChIKey | AWQAHBDQSJMJEU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.00 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|