C19H17ClN4O5S — CID 4271038
4-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-N,N-dimethylbenzenesulfonamide (PubChem CID 4271038) has the molecular formula C19H17ClN4O5S and a molecular weight of 448.89 g/mol. Its IUPAC name is 4-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 4271038 |
| Molecular Formula | C19H17ClN4O5S |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 4-[[1-(3-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(/N=C/c2c(O)n(-c3cccc(Cl)c3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C19H17ClN4O5S/c1-23(2)30(28,29)15-8-6-13(7-9-15)21-11-16-17(25)22-19(27)24(18(16)26)14-5-3-4-12(20)10-14/h3-11,26H,1-2H3,(H,22,25,27)/b21-11+ |
| InChIKey | LDCRENLLTXUHLB-SRZZPIQSSA-N |
| XLogP | 1.89 |
| TPSA | 124.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|