C21H19N3O4 — CID 4271164
N-(4-acetylphenyl)-2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetamide (PubChem CID 4271164) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetamide.
| Compound Name | N-(4-acetylphenyl)-2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetamide |
|---|---|
| PubChem CID | 4271164 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-(4-acetylphenyl)-2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetamide |
| SMILES | CC(=O)c1ccc(NC(=O)CN2C(=O)NC3(CCc4ccccc43)C2=O)cc1 |
| InChI | InChI=1S/C21H19N3O4/c1-13(25)14-6-8-16(9-7-14)22-18(26)12-24-19(27)21(23-20(24)28)11-10-15-4-2-3-5-17(15)21/h2-9H,10-12H2,1H3,(H,22,26)(H,23,28) |
| InChIKey | GLWXQBNTNOALBA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|