C23H27BrN4O3S — CID 42714519
2-[1-[4-(4-bromophenyl)sulfonyl-3-methylpiperazin-1-yl]ethyl]-3-ethylquinazolin-4-one (PubChem CID 42714519) has the molecular formula C23H27BrN4O3S and a molecular weight of 519.47 g/mol. Its IUPAC name is 2-[1-[4-(4-bromophenyl)sulfonyl-3-methylpiperazin-1-yl]ethyl]-3-ethylquinazolin-4-one.
| Compound Name | 2-[1-[4-(4-bromophenyl)sulfonyl-3-methylpiperazin-1-yl]ethyl]-3-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 42714519 |
| Molecular Formula | C23H27BrN4O3S |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | 2-[1-[4-(4-bromophenyl)sulfonyl-3-methylpiperazin-1-yl]ethyl]-3-ethylquinazolin-4-one |
| SMILES | CCn1c(C(C)N2CCN(S(=O)(=O)c3ccc(Br)cc3)C(C)C2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H27BrN4O3S/c1-4-27-22(25-21-8-6-5-7-20(21)23(27)29)17(3)26-13-14-28(16(2)15-26)32(30,31)19-11-9-18(24)10-12-19/h5-12,16-17H,4,13-15H2,1-3H3 |
| InChIKey | RLOZEJPYMRDVNO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |