C22H32ClN5O2 — CID 42714867
N-butyl-4-[1-(6-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]-2-methylpiperazine-1-carboxamide (PubChem CID 42714867) has the molecular formula C22H32ClN5O2 and a molecular weight of 433.98 g/mol. Its IUPAC name is N-butyl-4-[1-(6-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]-2-methylpiperazine-1-carboxamide.
| Compound Name | N-butyl-4-[1-(6-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]-2-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 42714867 |
| Molecular Formula | C22H32ClN5O2 |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | N-butyl-4-[1-(6-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl]-2-methylpiperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(C(C)c2nc3ccc(Cl)cc3c(=O)n2CC)CC1C |
| InChI | InChI=1S/C22H32ClN5O2/c1-5-7-10-24-22(30)28-12-11-26(14-15(28)3)16(4)20-25-19-9-8-17(23)13-18(19)21(29)27(20)6-2/h8-9,13,15-16H,5-7,10-12,14H2,1-4H3,(H,24,30) |
| InChIKey | HBTHGKHNIUZZBE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|