C13H6Cl5NO2 — CID 4271561
2,2,2-trichloro-1-[4-(2,3-dichlorobenzoyl)-1H-pyrrol-2-yl]ethanone (PubChem CID 4271561) has the molecular formula C13H6Cl5NO2 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[4-(2,3-dichlorobenzoyl)-1H-pyrrol-2-yl]ethanone.
| Compound Name | 2,2,2-trichloro-1-[4-(2,3-dichlorobenzoyl)-1H-pyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 4271561 |
| Molecular Formula | C13H6Cl5NO2 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 382.88 |
| IUPAC Name | 2,2,2-trichloro-1-[4-(2,3-dichlorobenzoyl)-1H-pyrrol-2-yl]ethanone |
| SMILES | O=C(c1c[nH]c(C(=O)C(Cl)(Cl)Cl)c1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H6Cl5NO2/c14-8-3-1-2-7(10(8)15)11(20)6-4-9(19-5-6)12(21)13(16,17)18/h1-5,19H |
| InChIKey | QPHDMIZLOLVXTN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|