About N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide
N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide (PubChem CID 4271700) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide |
| PubChem CID | 4271700 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide |
| SMILES | CC(=O)Nc1[nH]c(C)c(C)c1C#N |
| InChI | InChI=1S/C9H11N3O/c1-5-6(2)11-9(8(5)4-10)12-7(3)13/h11H,1-3H3,(H,12,13) |
| InChIKey | YUQQEKSAOOLWLK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide?
The IUPAC name of N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide (CID 4271700) is N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide.
What is the SMILES notation for N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide?
The canonical SMILES for N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide is CC(=O)Nc1[nH]c(C)c(C)c1C#N.
What is the InChIKey of N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide?
The InChIKey is YUQQEKSAOOLWLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c1-5-6(2)11-9(8(5)4-10)12-7(3)13/h11H,1-3H3,(H,12,13).
What are the key properties of N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide?
N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide has a molecular weight of 177.21 g/mol, XLogP of 1.46, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-cyano-4,5-dimethyl-1H-pyrrol-2-yl)acetamide is sourced from PubChem (CID 4271700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).