C23H25ClN4O2 — CID 42717155
2-[1-[4-(4-chlorobenzoyl)piperazin-1-yl]ethyl]-3-ethylquinazolin-4-one (PubChem CID 42717155) has the molecular formula C23H25ClN4O2 and a molecular weight of 424.93 g/mol. Its IUPAC name is 2-[1-[4-(4-chlorobenzoyl)piperazin-1-yl]ethyl]-3-ethylquinazolin-4-one.
| Compound Name | 2-[1-[4-(4-chlorobenzoyl)piperazin-1-yl]ethyl]-3-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 42717155 |
| Molecular Formula | C23H25ClN4O2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 2-[1-[4-(4-chlorobenzoyl)piperazin-1-yl]ethyl]-3-ethylquinazolin-4-one |
| SMILES | CCn1c(C(C)N2CCN(C(=O)c3ccc(Cl)cc3)CC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H25ClN4O2/c1-3-28-21(25-20-7-5-4-6-19(20)23(28)30)16(2)26-12-14-27(15-13-26)22(29)17-8-10-18(24)11-9-17/h4-11,16H,3,12-15H2,1-2H3 |
| InChIKey | UOVUTGAFOWWKNI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |