C30H27N3O2S — CID 42717251
N-benzyl-N-[1-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]propyl]thiophene-2-carboxamide (PubChem CID 42717251) has the molecular formula C30H27N3O2S and a molecular weight of 493.63 g/mol. Its IUPAC name is N-benzyl-N-[1-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]propyl]thiophene-2-carboxamide.
| Compound Name | N-benzyl-N-[1-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42717251 |
| Molecular Formula | C30H27N3O2S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | N-benzyl-N-[1-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]propyl]thiophene-2-carboxamide |
| SMILES | CCC(c1nc2ccccc2c(=O)n1-c1ccc(C)cc1)N(Cc1ccccc1)C(=O)c1cccs1 |
| InChI | InChI=1S/C30H27N3O2S/c1-3-26(32(20-22-10-5-4-6-11-22)30(35)27-14-9-19-36-27)28-31-25-13-8-7-12-24(25)29(34)33(28)23-17-15-21(2)16-18-23/h4-19,26H,3,20H2,1-2H3 |
| InChIKey | NKYUKAQUDLKTSE-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |