About 4-nitro-5-(2-phenyl-4,5-dihydroimidazol-1-yl)-2,1,3-benzoxadiazole
4-nitro-5-(2-phenyl-4,5-dihydroimidazol-1-yl)-2,1,3-benzoxadiazole (PubChem CID 4271792) has the molecular formula C15H11N5O3
and a molecular weight of 309.28 g/mol. Its IUPAC name is 4-nitro-5-(2-phenyl-4,5-dihydroimidazol-1-yl)-2,1,3-benzoxadiazole.
Molecular Properties
| Compound Name | 4-nitro-5-(2-phenyl-4,5-dihydroimidazol-1-yl)-2,1,3-benzoxadiazole |
| PubChem CID | 4271792 |
| Molecular Formula | C15H11N5O3 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 4-nitro-5-(2-phenyl-4,5-dihydroimidazol-1-yl)-2,1,3-benzoxadiazole |
| SMILES | O=[N+]([O-])c1c(N2CCN=C2c2ccccc2)ccc2nonc12 |
| InChI | InChI=1S/C15H11N5O3/c21-20(22)14-12(7-6-11-13(14)18-23-17-11)19-9-8-16-15(19)10-4-2-1-3-5-10/h1-7H,8-9H2 |
| InChIKey | KDAZUZFRWSMKMR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 97.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-5-(2-phenyl-4,5-dihydroimidazol-1-yl)-2,1,3-benzoxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-5-(2-phenyl-4,5-dihydroimidazol-1-yl)-2,1,3-benzoxadiazole?
The IUPAC name of 4-nitro-5-(2-phenyl-4,5-dihydroimidazol-1-yl)-2,1,3-benzoxadiazole (CID 4271792) is 4-nitro-5-(2-phenyl-4,5-dihydroimidazol-1-yl)-2,1,3-benzoxadiazole.
What is the SMILES notation for 4-nitro-5-(2-phenyl-4,5-dihydroimidazol-1-yl)-2,1,3-benzoxadiazole?
The canonical SMILES for 4-nitro-5-(2-phenyl-4,5-dihydroimidazol-1-yl)-2,1,3-benzoxadiazole is O=[N+]([O-])c1c(N2CCN=C2c2ccccc2)ccc2nonc12.
What is the InChIKey of 4-nitro-5-(2-phenyl-4,5-dihydroimidazol-1-yl)-2,1,3-benzoxadiazole?
The InChIKey is KDAZUZFRWSMKMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N5O3/c21-20(22)14-12(7-6-11-13(14)18-23-17-11)19-9-8-16-15(19)10-4-2-1-3-5-10/h1-7H,8-9H2.
What are the key properties of 4-nitro-5-(2-phenyl-4,5-dihydroimidazol-1-yl)-2,1,3-benzoxadiazole?
4-nitro-5-(2-phenyl-4,5-dihydroimidazol-1-yl)-2,1,3-benzoxadiazole has a molecular weight of 309.28 g/mol, XLogP of 2.40, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-5-(2-phenyl-4,5-dihydroimidazol-1-yl)-2,1,3-benzoxadiazole is sourced from PubChem (CID 4271792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).