C16H23N5O2S2 — CID 4271986
1-[3-[[4-(dimethylamino)phenyl]methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-methylurea (PubChem CID 4271986) has the molecular formula C16H23N5O2S2 and a molecular weight of 381.53 g/mol. Its IUPAC name is 1-[3-[[4-(dimethylamino)phenyl]methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-methylurea.
| Compound Name | 1-[3-[[4-(dimethylamino)phenyl]methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-methylurea |
|---|---|
| PubChem CID | 4271986 |
| Molecular Formula | C16H23N5O2S2 |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 1-[3-[[4-(dimethylamino)phenyl]methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-methylurea |
| SMILES | CNC(=O)N(O)C1N(N=Cc2ccc(N(C)C)cc2)C(=S)SC1(C)C |
| InChI | InChI=1S/C16H23N5O2S2/c1-16(2)13(21(23)14(22)17-3)20(15(24)25-16)18-10-11-6-8-12(9-7-11)19(4)5/h6-10,13,23H,1-5H3,(H,17,22) |
| InChIKey | NTWIGNCOACPQAH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|