C21H22N2O4 — CID 42727348
[3-ethyl-1-(2-methylphenyl)pyrazol-5-yl] 2,4-dimethoxybenzoate (PubChem CID 42727348) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is [3-ethyl-1-(2-methylphenyl)pyrazol-5-yl] 2,4-dimethoxybenzoate.
| Compound Name | [3-ethyl-1-(2-methylphenyl)pyrazol-5-yl] 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 42727348 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | [3-ethyl-1-(2-methylphenyl)pyrazol-5-yl] 2,4-dimethoxybenzoate |
| SMILES | CCc1cc(OC(=O)c2ccc(OC)cc2OC)n(-c2ccccc2C)n1 |
| InChI | InChI=1S/C21H22N2O4/c1-5-15-12-20(23(22-15)18-9-7-6-8-14(18)2)27-21(24)17-11-10-16(25-3)13-19(17)26-4/h6-13H,5H2,1-4H3 |
| InChIKey | UWZNEOXLHOQNSF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |