C15H13Br2N3O2S — CID 4272831
N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide (PubChem CID 4272831) has the molecular formula C15H13Br2N3O2S and a molecular weight of 459.16 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide.
| Compound Name | N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 4272831 |
| Molecular Formula | C15H13Br2N3O2S |
| Molecular Weight | 459.16 g/mol |
| Exact Mass | 456.91 |
| IUPAC Name | N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide |
| SMILES | CC(Sc1ccccn1)C(=O)NN=Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C15H13Br2N3O2S/c1-9(23-13-4-2-3-5-18-13)15(22)20-19-8-10-6-11(16)14(21)12(17)7-10/h2-9,21H,1H3,(H,20,22) |
| InChIKey | HWHLCOYTSLJLLG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.16 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|