C17H19Cl2NO3S — CID 42728688
2-cyclohexyl-3-(2,4-dichlorobenzoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 42728688) has the molecular formula C17H19Cl2NO3S and a molecular weight of 388.32 g/mol. Its IUPAC name is 2-cyclohexyl-3-(2,4-dichlorobenzoyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-cyclohexyl-3-(2,4-dichlorobenzoyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 42728688 |
| Molecular Formula | C17H19Cl2NO3S |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 2-cyclohexyl-3-(2,4-dichlorobenzoyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CSC(C2CCCCC2)N1C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H19Cl2NO3S/c18-11-6-7-12(13(19)8-11)15(21)20-14(17(22)23)9-24-16(20)10-4-2-1-3-5-10/h6-8,10,14,16H,1-5,9H2,(H,22,23) |
| InChIKey | VSUNUZIAMFPVFS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |