About 2-[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]acenaphthylen-1-one
2-[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]acenaphthylen-1-one (PubChem CID 4272869) has the molecular formula C17H8Cl3N3O
and a molecular weight of 376.63 g/mol. Its IUPAC name is 2-[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]acenaphthylen-1-one.
Molecular Properties
| Compound Name | 2-[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]acenaphthylen-1-one |
| PubChem CID | 4272869 |
| Molecular Formula | C17H8Cl3N3O |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 2-[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]acenaphthylen-1-one |
| SMILES | O=C1C(=NNc2nc(Cl)c(Cl)cc2Cl)c2cccc3cccc1c23 |
| InChI | InChI=1S/C17H8Cl3N3O/c18-11-7-12(19)17(21-16(11)20)23-22-14-9-5-1-3-8-4-2-6-10(13(8)9)15(14)24/h1-7H,(H,21,23) |
| InChIKey | NHRQPAWBPLIRIX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]acenaphthylen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]acenaphthylen-1-one?
The IUPAC name of 2-[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]acenaphthylen-1-one (CID 4272869) is 2-[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]acenaphthylen-1-one.
What is the SMILES notation for 2-[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]acenaphthylen-1-one?
The canonical SMILES for 2-[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]acenaphthylen-1-one is O=C1C(=NNc2nc(Cl)c(Cl)cc2Cl)c2cccc3cccc1c23.
What is the InChIKey of 2-[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]acenaphthylen-1-one?
The InChIKey is NHRQPAWBPLIRIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H8Cl3N3O/c18-11-7-12(19)17(21-16(11)20)23-22-14-9-5-1-3-8-4-2-6-10(13(8)9)15(14)24/h1-7H,(H,21,23).
What are the key properties of 2-[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]acenaphthylen-1-one?
2-[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]acenaphthylen-1-one has a molecular weight of 376.63 g/mol, XLogP of 5.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]acenaphthylen-1-one is sourced from PubChem (CID 4272869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).