C25H31N3O4 — CID 42729114
N-[1-(3-ethyl-4-oxoquinazolin-2-yl)ethyl]-N-(3-methoxypropyl)-2-phenylmethoxyacetamide (PubChem CID 42729114) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[1-(3-ethyl-4-oxoquinazolin-2-yl)ethyl]-N-(3-methoxypropyl)-2-phenylmethoxyacetamide.
| Compound Name | N-[1-(3-ethyl-4-oxoquinazolin-2-yl)ethyl]-N-(3-methoxypropyl)-2-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 42729114 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | N-[1-(3-ethyl-4-oxoquinazolin-2-yl)ethyl]-N-(3-methoxypropyl)-2-phenylmethoxyacetamide |
| SMILES | CCn1c(C(C)N(CCCOC)C(=O)COCc2ccccc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C25H31N3O4/c1-4-27-24(26-22-14-9-8-13-21(22)25(27)30)19(2)28(15-10-16-31-3)23(29)18-32-17-20-11-6-5-7-12-20/h5-9,11-14,19H,4,10,15-18H2,1-3H3 |
| InChIKey | LFNUSNJZAAZHJD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|