C20H18Br2N4O2S — CID 4273193
N-(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide (PubChem CID 4273193) has the molecular formula C20H18Br2N4O2S and a molecular weight of 538.27 g/mol. Its IUPAC name is N-(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide.
| Compound Name | N-(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4273193 |
| Molecular Formula | C20H18Br2N4O2S |
| Molecular Weight | 538.27 g/mol |
| Exact Mass | 535.95 |
| IUPAC Name | N-(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1c(Br)cc(Br)cc1C=CC(=O)Nn1c(C)nnc1SCc1ccccc1 |
| InChI | InChI=1S/C20H18Br2N4O2S/c1-13-23-24-20(29-12-14-6-4-3-5-7-14)26(13)25-18(27)9-8-15-10-16(21)11-17(22)19(15)28-2/h3-11H,12H2,1-2H3,(H,25,27) |
| InChIKey | ZMNILJAALQBRLG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.27 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|