C22H26N4OS — CID 42734322
2-[[5-benzyl-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-butylacetamide (PubChem CID 42734322) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is 2-[[5-benzyl-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-butylacetamide.
| Compound Name | 2-[[5-benzyl-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-butylacetamide |
|---|---|
| PubChem CID | 42734322 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2-[[5-benzyl-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-butylacetamide |
| SMILES | CCCCNC(=O)CSc1nnc(Cc2ccccc2)n1-c1cccc(C)c1 |
| InChI | InChI=1S/C22H26N4OS/c1-3-4-13-23-21(27)16-28-22-25-24-20(15-18-10-6-5-7-11-18)26(22)19-12-8-9-17(2)14-19/h5-12,14H,3-4,13,15-16H2,1-2H3,(H,23,27) |
| InChIKey | XEIBBYCTNYFJMI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|