C25H29BrN4O4S — CID 42737325
N-[3-[[5-(3-bromophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxopropyl]-4-butoxy-N-(2-methoxyethyl)benzamide (PubChem CID 42737325) has the molecular formula C25H29BrN4O4S and a molecular weight of 561.50 g/mol. Its IUPAC name is N-[3-[[5-(3-bromophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxopropyl]-4-butoxy-N-(2-methoxyethyl)benzamide.
| Compound Name | N-[3-[[5-(3-bromophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxopropyl]-4-butoxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 42737325 |
| Molecular Formula | C25H29BrN4O4S |
| Molecular Weight | 561.50 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | N-[3-[[5-(3-bromophenyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxopropyl]-4-butoxy-N-(2-methoxyethyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(CCOC)CCC(=O)Nc2nnc(-c3cccc(Br)c3)s2)cc1 |
| InChI | InChI=1S/C25H29BrN4O4S/c1-3-4-15-34-21-10-8-18(9-11-21)24(32)30(14-16-33-2)13-12-22(31)27-25-29-28-23(35-25)19-6-5-7-20(26)17-19/h5-11,17H,3-4,12-16H2,1-2H3,(H,27,29,31) |
| InChIKey | GFVCPJTZQKSJDO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|