C25H31N5O2S — CID 42737344
3-[butylcarbamoyl(2-phenylethyl)amino]-N-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 42737344) has the molecular formula C25H31N5O2S and a molecular weight of 465.62 g/mol. Its IUPAC name is 3-[butylcarbamoyl(2-phenylethyl)amino]-N-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 3-[butylcarbamoyl(2-phenylethyl)amino]-N-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 42737344 |
| Molecular Formula | C25H31N5O2S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 3-[butylcarbamoyl(2-phenylethyl)amino]-N-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CCCCNC(=O)N(CCC(=O)Nc1nnc(-c2cccc(C)c2)s1)CCc1ccccc1 |
| InChI | InChI=1S/C25H31N5O2S/c1-3-4-15-26-25(32)30(16-13-20-10-6-5-7-11-20)17-14-22(31)27-24-29-28-23(33-24)21-12-8-9-19(2)18-21/h5-12,18H,3-4,13-17H2,1-2H3,(H,26,32)(H,27,29,31) |
| InChIKey | DPRATKVATOCFPX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|