C20H21Br2N3 — CID 42738388
N-benzyl-6,8-dibromo-2-cyclohexylimidazo[1,2-a]pyridin-3-amine (PubChem CID 42738388) has the molecular formula C20H21Br2N3 and a molecular weight of 463.22 g/mol. Its IUPAC name is N-benzyl-6,8-dibromo-2-cyclohexylimidazo[1,2-a]pyridin-3-amine.
| Compound Name | N-benzyl-6,8-dibromo-2-cyclohexylimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 42738388 |
| Molecular Formula | C20H21Br2N3 |
| Molecular Weight | 463.22 g/mol |
| Exact Mass | 461.01 |
| IUPAC Name | N-benzyl-6,8-dibromo-2-cyclohexylimidazo[1,2-a]pyridin-3-amine |
| SMILES | Brc1cc(Br)c2nc(C3CCCCC3)c(NCc3ccccc3)n2c1 |
| InChI | InChI=1S/C20H21Br2N3/c21-16-11-17(22)19-24-18(15-9-5-2-6-10-15)20(25(19)13-16)23-12-14-7-3-1-4-8-14/h1,3-4,7-8,11,13,15,23H,2,5-6,9-10,12H2 |
| InChIKey | PJMAAISGXPDVSP-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.22 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |